C31H36FNO4 — CID 70696719
ethyl 6-[3-[[[4-(3-fluorophenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate (PubChem CID 70696719) has the molecular formula C31H36FNO4 and a molecular weight of 505.63 g/mol. Its IUPAC name is ethyl 6-[3-[[[4-(3-fluorophenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate.
| Compound Name | ethyl 6-[3-[[[4-(3-fluorophenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 70696719 |
| Molecular Formula | C31H36FNO4 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | ethyl 6-[3-[[[4-(3-fluorophenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1cccc(CN(C(=O)c2ccc(-c3cccc(F)c3)cc2)C(C)C)c1 |
| InChI | InChI=1S/C31H36FNO4/c1-4-36-30(34)14-6-5-7-19-37-29-13-8-10-24(20-29)22-33(23(2)3)31(35)26-17-15-25(16-18-26)27-11-9-12-28(32)21-27/h8-13,15-18,20-21,23H,4-7,14,19,22H2,1-3H3 |
| InChIKey | HPGDDXCDUBSENW-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|