C27H31NO4S — CID 70696708
6-[3-[[propan-2-yl-(4-thiophen-3-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid (PubChem CID 70696708) has the molecular formula C27H31NO4S and a molecular weight of 465.62 g/mol. Its IUPAC name is 6-[3-[[propan-2-yl-(4-thiophen-3-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid.
| Compound Name | 6-[3-[[propan-2-yl-(4-thiophen-3-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 70696708 |
| Molecular Formula | C27H31NO4S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 6-[3-[[propan-2-yl-(4-thiophen-3-ylbenzoyl)amino]methyl]phenoxy]hexanoic acid |
| SMILES | CC(C)N(Cc1cccc(OCCCCCC(=O)O)c1)C(=O)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C27H31NO4S/c1-20(2)28(27(31)23-12-10-22(11-13-23)24-14-16-33-19-24)18-21-7-6-8-25(17-21)32-15-5-3-4-9-26(29)30/h6-8,10-14,16-17,19-20H,3-5,9,15,18H2,1-2H3,(H,29,30) |
| InChIKey | JHEQGSNNOKXHNZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|