About 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane
6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane (PubChem CID 161096653) has the molecular formula C17H28O3S
and a molecular weight of 312.48 g/mol. Its IUPAC name is 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane.
Molecular Properties
| Compound Name | 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane |
| PubChem CID | 161096653 |
| Molecular Formula | C17H28O3S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane |
| SMILES | CC[C@@H](C)Cc1cccc(OCCCCCC(=O)O)c1.S |
| InChI | InChI=1S/C17H26O3.H2S/c1-3-14(2)12-15-8-7-9-16(13-15)20-11-6-4-5-10-17(18)19;/h7-9,13-14H,3-6,10-12H2,1-2H3,(H,18,19);1H2/t14-;/m1./s1 |
| InChIKey | UHWQAKLXSDYSIL-PFEQFJNWSA-N |
| XLogP | 4.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane?
The IUPAC name of 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane (CID 161096653) is 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane.
What is the SMILES notation for 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane?
The canonical SMILES for 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane is CC[C@@H](C)Cc1cccc(OCCCCCC(=O)O)c1.S.
What is the InChIKey of 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane?
The InChIKey is UHWQAKLXSDYSIL-PFEQFJNWSA-N. The full InChI is InChI=1S/C17H26O3.H2S/c1-3-14(2)12-15-8-7-9-16(13-15)20-11-6-4-5-10-17(18)19;/h7-9,13-14H,3-6,10-12H2,1-2H3,(H,18,19);1H2/t14-;/m1./s1.
What are the key properties of 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane?
6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane has a molecular weight of 312.48 g/mol, XLogP of 4.41, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-[(2R)-2-methylbutyl]phenoxy]hexanoic acid;sulfane is sourced from PubChem (CID 161096653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).