C29H43NO3 — CID 44550617
methyl 10-[3-[(2S)-2-[methyl-[(1S)-1-phenylethyl]amino]propyl]phenoxy]decanoate (PubChem CID 44550617) has the molecular formula C29H43NO3 and a molecular weight of 453.67 g/mol. Its IUPAC name is methyl 10-[3-[(2S)-2-[methyl-[(1S)-1-phenylethyl]amino]propyl]phenoxy]decanoate.
| Compound Name | methyl 10-[3-[(2S)-2-[methyl-[(1S)-1-phenylethyl]amino]propyl]phenoxy]decanoate |
|---|---|
| PubChem CID | 44550617 |
| Molecular Formula | C29H43NO3 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | methyl 10-[3-[(2S)-2-[methyl-[(1S)-1-phenylethyl]amino]propyl]phenoxy]decanoate |
| SMILES | COC(=O)CCCCCCCCCOc1cccc(C[C@H](C)N(C)[C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C29H43NO3/c1-24(30(3)25(2)27-17-11-10-12-18-27)22-26-16-15-19-28(23-26)33-21-14-9-7-5-6-8-13-20-29(31)32-4/h10-12,15-19,23-25H,5-9,13-14,20-22H2,1-4H3/t24-,25-/m0/s1 |
| InChIKey | KFMZUWZJYUYNLN-DQEYMECFSA-N |
| XLogP | 6.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|