C31H34FNO7 — CID 71598273
carboxy 6-[3-[[[4-(3-fluoro-5-methoxyphenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate (PubChem CID 71598273) has the molecular formula C31H34FNO7 and a molecular weight of 551.61 g/mol. Its IUPAC name is carboxy 6-[3-[[[4-(3-fluoro-5-methoxyphenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate.
| Compound Name | carboxy 6-[3-[[[4-(3-fluoro-5-methoxyphenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 71598273 |
| Molecular Formula | C31H34FNO7 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | carboxy 6-[3-[[[4-(3-fluoro-5-methoxyphenyl)benzoyl]-propan-2-ylamino]methyl]phenoxy]hexanoate |
| SMILES | COc1cc(F)cc(-c2ccc(C(=O)N(Cc3cccc(OCCCCCC(=O)OC(=O)O)c3)C(C)C)cc2)c1 |
| InChI | InChI=1S/C31H34FNO7/c1-21(2)33(30(35)24-13-11-23(12-14-24)25-17-26(32)19-28(18-25)38-3)20-22-8-7-9-27(16-22)39-15-6-4-5-10-29(34)40-31(36)37/h7-9,11-14,16-19,21H,4-6,10,15,20H2,1-3H3,(H,36,37) |
| InChIKey | CEIQIURNSYCPJZ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|