C30H37N3O4 — CID 67780051
N-benzyl-4-[5-(3-methanehydrazonoylphenoxy)pentoxy]-3-methoxy-N-propan-2-ylbenzamide (PubChem CID 67780051) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is N-benzyl-4-[5-(3-methanehydrazonoylphenoxy)pentoxy]-3-methoxy-N-propan-2-ylbenzamide.
| Compound Name | N-benzyl-4-[5-(3-methanehydrazonoylphenoxy)pentoxy]-3-methoxy-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 67780051 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | N-benzyl-4-[5-(3-methanehydrazonoylphenoxy)pentoxy]-3-methoxy-N-propan-2-ylbenzamide |
| SMILES | COc1cc(C(=O)N(Cc2ccccc2)C(C)C)ccc1OCCCCCOc1cccc(C=NN)c1 |
| InChI | InChI=1S/C30H37N3O4/c1-23(2)33(22-24-11-6-4-7-12-24)30(34)26-15-16-28(29(20-26)35-3)37-18-9-5-8-17-36-27-14-10-13-25(19-27)21-32-31/h4,6-7,10-16,19-21,23H,5,8-9,17-18,22,31H2,1-3H3 |
| InChIKey | HDHLXTVGEGMEGT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|