C28H33N3O3 — CID 67908932
4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N-phenyl-N-propan-2-ylbenzamide (PubChem CID 67908932) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is 4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N-phenyl-N-propan-2-ylbenzamide.
| Compound Name | 4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N-phenyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 67908932 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N-phenyl-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(C(=O)c1ccc(OCCCCCOc2ccc(C=NN)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H33N3O3/c1-22(2)31(25-9-5-3-6-10-25)28(32)24-13-17-27(18-14-24)34-20-8-4-7-19-33-26-15-11-23(12-16-26)21-30-29/h3,5-6,9-18,21-22H,4,7-8,19-20,29H2,1-2H3 |
| InChIKey | RLDVVSJUKOFWIG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|