C28H30N2O3 — CID 57300714
3-[5-(4-cyanophenoxy)pentoxy]-N-phenyl-N-propan-2-ylbenzamide (PubChem CID 57300714) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-[5-(4-cyanophenoxy)pentoxy]-N-phenyl-N-propan-2-ylbenzamide.
| Compound Name | 3-[5-(4-cyanophenoxy)pentoxy]-N-phenyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 57300714 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 3-[5-(4-cyanophenoxy)pentoxy]-N-phenyl-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(C(=O)c1cccc(OCCCCCOc2ccc(C#N)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C28H30N2O3/c1-22(2)30(25-11-5-3-6-12-25)28(31)24-10-9-13-27(20-24)33-19-8-4-7-18-32-26-16-14-23(21-29)15-17-26/h3,5-6,9-17,20,22H,4,7-8,18-19H2,1-2H3 |
| InChIKey | PXZDPIJILRMUAR-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|