C28H32ClN3O3 — CID 15340522
4-[5-(4-carbamimidoylphenoxy)pentoxy]-2-chloro-N-phenyl-N-propan-2-ylbenzamide (PubChem CID 15340522) has the molecular formula C28H32ClN3O3 and a molecular weight of 494.04 g/mol. Its IUPAC name is 4-[5-(4-carbamimidoylphenoxy)pentoxy]-2-chloro-N-phenyl-N-propan-2-ylbenzamide.
| Compound Name | 4-[5-(4-carbamimidoylphenoxy)pentoxy]-2-chloro-N-phenyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 15340522 |
| Molecular Formula | C28H32ClN3O3 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 4-[5-(4-carbamimidoylphenoxy)pentoxy]-2-chloro-N-phenyl-N-propan-2-ylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCCCCOc2ccc(C(=O)N(c3ccccc3)C(C)C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C28H32ClN3O3/c1-20(2)32(22-9-5-3-6-10-22)28(33)25-16-15-24(19-26(25)29)35-18-8-4-7-17-34-23-13-11-21(12-14-23)27(30)31/h3,5-6,9-16,19-20H,4,7-8,17-18H2,1-2H3,(H3,30,31) |
| InChIKey | DKBQCRQOLCJLAS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|