C37H47N3O7 — CID 19040947
ethyl 2-methyl-2-[2-[phenyl(propan-2-yl)carbamoyl]-5-[5-[4-(N'-propanoylcarbamimidoyl)phenoxy]pentoxy]phenoxy]propanoate (PubChem CID 19040947) has the molecular formula C37H47N3O7 and a molecular weight of 645.80 g/mol. Its IUPAC name is ethyl 2-methyl-2-[2-[phenyl(propan-2-yl)carbamoyl]-5-[5-[4-(N'-propanoylcarbamimidoyl)phenoxy]pentoxy]phenoxy]propanoate.
| Compound Name | ethyl 2-methyl-2-[2-[phenyl(propan-2-yl)carbamoyl]-5-[5-[4-(N'-propanoylcarbamimidoyl)phenoxy]pentoxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 19040947 |
| Molecular Formula | C37H47N3O7 |
| Molecular Weight | 645.80 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | ethyl 2-methyl-2-[2-[phenyl(propan-2-yl)carbamoyl]-5-[5-[4-(N'-propanoylcarbamimidoyl)phenoxy]pentoxy]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1cc(OCCCCCOc2ccc(/C(N)=N/C(=O)CC)cc2)ccc1C(=O)N(c1ccccc1)C(C)C |
| InChI | InChI=1S/C37H47N3O7/c1-7-33(41)39-34(38)27-17-19-29(20-18-27)45-23-13-10-14-24-46-30-21-22-31(32(25-30)47-37(5,6)36(43)44-8-2)35(42)40(26(3)4)28-15-11-9-12-16-28/h9,11-12,15-22,25-26H,7-8,10,13-14,23-24H2,1-6H3,(H2,38,39,41) |
| InChIKey | DPIHHMDOJWGZEE-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.80 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|