C23H29NO6 — CID 22633458
2-(benzylamino)-4-[4-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxyphenoxy]butanoic acid (PubChem CID 22633458) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-(benzylamino)-4-[4-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxyphenoxy]butanoic acid.
| Compound Name | 2-(benzylamino)-4-[4-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 22633458 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-(benzylamino)-4-[4-(1-ethoxy-2-methyl-1-oxopropan-2-yl)oxyphenoxy]butanoic acid |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(OCCC(NCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C23H29NO6/c1-4-28-22(27)23(2,3)30-19-12-10-18(11-13-19)29-15-14-20(21(25)26)24-16-17-8-6-5-7-9-17/h5-13,20,24H,4,14-16H2,1-3H3,(H,25,26) |
| InChIKey | GCIZGRHYYMSDSR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |