C24H29NO5 — CID 142118363
ethyl 2-[4-[(Z)-3-(benzylideneamino)-4-hydroxypent-3-enoxy]phenoxy]-2-methylpropanoate (PubChem CID 142118363) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is ethyl 2-[4-[(Z)-3-(benzylideneamino)-4-hydroxypent-3-enoxy]phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[(Z)-3-(benzylideneamino)-4-hydroxypent-3-enoxy]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 142118363 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | ethyl 2-[4-[(Z)-3-(benzylideneamino)-4-hydroxypent-3-enoxy]phenoxy]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(OCCC(/N=C/c2ccccc2)=C(\C)O)cc1 |
| InChI | InChI=1S/C24H29NO5/c1-5-28-23(27)24(3,4)30-21-13-11-20(12-14-21)29-16-15-22(18(2)26)25-17-19-9-7-6-8-10-19/h6-14,17,26H,5,15-16H2,1-4H3/b22-18-,25-17+ |
| InChIKey | HVCNAMZQCTZXPY-LZGDAENQSA-N |
| XLogP | 5.08 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|