C33H48N2O7 — CID 19040973
ethyl 2-[2-[di(propan-2-yl)carbamoyl]-5-[5-[4-(C-ethoxycarbonimidoyl)phenoxy]pentoxy]phenoxy]-2-methylpropanoate (PubChem CID 19040973) has the molecular formula C33H48N2O7 and a molecular weight of 584.75 g/mol. Its IUPAC name is ethyl 2-[2-[di(propan-2-yl)carbamoyl]-5-[5-[4-(C-ethoxycarbonimidoyl)phenoxy]pentoxy]phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[2-[di(propan-2-yl)carbamoyl]-5-[5-[4-(C-ethoxycarbonimidoyl)phenoxy]pentoxy]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 19040973 |
| Molecular Formula | C33H48N2O7 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | ethyl 2-[2-[di(propan-2-yl)carbamoyl]-5-[5-[4-(C-ethoxycarbonimidoyl)phenoxy]pentoxy]phenoxy]-2-methylpropanoate |
| SMILES | [H]/N=C(\OCC)c1ccc(OCCCCCOc2ccc(C(=O)N(C(C)C)C(C)C)c(OC(C)(C)C(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C33H48N2O7/c1-9-38-30(34)25-14-16-26(17-15-25)40-20-12-11-13-21-41-27-18-19-28(31(36)35(23(3)4)24(5)6)29(22-27)42-33(7,8)32(37)39-10-2/h14-19,22-24,34H,9-13,20-21H2,1-8H3/b34-30- |
| InChIKey | HDNFPLDGWNXAOI-BVNFUTIRSA-N |
| XLogP | 6.66 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|