C29H41N3O5 — CID 18991803
4-[5-[4-(N'-butanoylcarbamimidoyl)phenoxy]pentoxy]-2-hydroxy-N,N-di(propan-2-yl)benzamide (PubChem CID 18991803) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is 4-[5-[4-(N'-butanoylcarbamimidoyl)phenoxy]pentoxy]-2-hydroxy-N,N-di(propan-2-yl)benzamide.
| Compound Name | 4-[5-[4-(N'-butanoylcarbamimidoyl)phenoxy]pentoxy]-2-hydroxy-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 18991803 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | 4-[5-[4-(N'-butanoylcarbamimidoyl)phenoxy]pentoxy]-2-hydroxy-N,N-di(propan-2-yl)benzamide |
| SMILES | CCCC(=O)/N=C(\N)c1ccc(OCCCCCOc2ccc(C(=O)N(C(C)C)C(C)C)c(O)c2)cc1 |
| InChI | InChI=1S/C29H41N3O5/c1-6-10-27(34)31-28(30)22-11-13-23(14-12-22)36-17-8-7-9-18-37-24-15-16-25(26(33)19-24)29(35)32(20(2)3)21(4)5/h11-16,19-21,33H,6-10,17-18H2,1-5H3,(H2,30,31,34) |
| InChIKey | MZQJUHBWLGJOQV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|