C29H41N3O7 — CID 173321974
2-[2-[di(propan-2-yl)carbamoyl]-5-[5-[4-(N'-hydroxycarbamimidoyl)phenoxy]pentoxy]phenoxy]butanoic acid (PubChem CID 173321974) has the molecular formula C29H41N3O7 and a molecular weight of 543.66 g/mol. Its IUPAC name is 2-[2-[di(propan-2-yl)carbamoyl]-5-[5-[4-(N'-hydroxycarbamimidoyl)phenoxy]pentoxy]phenoxy]butanoic acid.
| Compound Name | 2-[2-[di(propan-2-yl)carbamoyl]-5-[5-[4-(N'-hydroxycarbamimidoyl)phenoxy]pentoxy]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 173321974 |
| Molecular Formula | C29H41N3O7 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | 2-[2-[di(propan-2-yl)carbamoyl]-5-[5-[4-(N'-hydroxycarbamimidoyl)phenoxy]pentoxy]phenoxy]butanoic acid |
| SMILES | CCC(Oc1cc(OCCCCCOc2ccc(C(N)=NO)cc2)ccc1C(=O)N(C(C)C)C(C)C)C(=O)O |
| InChI | InChI=1S/C29H41N3O7/c1-6-25(29(34)35)39-26-18-23(14-15-24(26)28(33)32(19(2)3)20(4)5)38-17-9-7-8-16-37-22-12-10-21(11-13-22)27(30)31-36/h10-15,18-20,25,36H,6-9,16-17H2,1-5H3,(H2,30,31)(H,34,35) |
| InChIKey | IUCIZZGAMVFXFX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 143.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|