C27H39ClN4O5 — CID 19040944
2-(2-amino-2-oxoethoxy)-4-[5-[4-[(E)-hydrazinylidenemethyl]phenoxy]pentoxy]-N,N-di(propan-2-yl)benzamide;hydrochloride (PubChem CID 19040944) has the molecular formula C27H39ClN4O5 and a molecular weight of 535.09 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethoxy)-4-[5-[4-[(E)-hydrazinylidenemethyl]phenoxy]pentoxy]-N,N-di(propan-2-yl)benzamide;hydrochloride.
| Compound Name | 2-(2-amino-2-oxoethoxy)-4-[5-[4-[(E)-hydrazinylidenemethyl]phenoxy]pentoxy]-N,N-di(propan-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 19040944 |
| Molecular Formula | C27H39ClN4O5 |
| Molecular Weight | 535.09 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 2-(2-amino-2-oxoethoxy)-4-[5-[4-[(E)-hydrazinylidenemethyl]phenoxy]pentoxy]-N,N-di(propan-2-yl)benzamide;hydrochloride |
| SMILES | CC(C)N(C(=O)c1ccc(OCCCCCOc2ccc(/C=N/N)cc2)cc1OCC(N)=O)C(C)C.Cl |
| InChI | InChI=1S/C27H38N4O5.ClH/c1-19(2)31(20(3)4)27(33)24-13-12-23(16-25(24)36-18-26(28)32)35-15-7-5-6-14-34-22-10-8-21(9-11-22)17-30-29;/h8-13,16-17,19-20H,5-7,14-15,18,29H2,1-4H3,(H2,28,32);1H/b30-17+; |
| InChIKey | MZEPWMGZYFKXOJ-KZALGFBESA-N |
| XLogP | 4.15 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.09 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|