C25H34ClN3O3 — CID 67744746
3-chloro-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-di(propan-2-yl)benzamide (PubChem CID 67744746) has the molecular formula C25H34ClN3O3 and a molecular weight of 460.02 g/mol. Its IUPAC name is 3-chloro-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-di(propan-2-yl)benzamide.
| Compound Name | 3-chloro-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 67744746 |
| Molecular Formula | C25H34ClN3O3 |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 3-chloro-4-[5-(4-methanehydrazonoylphenoxy)pentoxy]-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1ccc(OCCCCCOc2ccc(C=NN)cc2)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C25H34ClN3O3/c1-18(2)29(19(3)4)25(30)21-10-13-24(23(26)16-21)32-15-7-5-6-14-31-22-11-8-20(9-12-22)17-28-27/h8-13,16-19H,5-7,14-15,27H2,1-4H3 |
| InChIKey | OGBKBRCEOBXCPH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|