C27H39N3O6S — CID 18991708
3-methoxy-4-[5-[4-[(Z)-N'-methylsulfonylcarbamimidoyl]phenoxy]pentoxy]-N,N-di(propan-2-yl)benzamide (PubChem CID 18991708) has the molecular formula C27H39N3O6S and a molecular weight of 533.69 g/mol. Its IUPAC name is 3-methoxy-4-[5-[4-[(Z)-N'-methylsulfonylcarbamimidoyl]phenoxy]pentoxy]-N,N-di(propan-2-yl)benzamide.
| Compound Name | 3-methoxy-4-[5-[4-[(Z)-N'-methylsulfonylcarbamimidoyl]phenoxy]pentoxy]-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 18991708 |
| Molecular Formula | C27H39N3O6S |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 3-methoxy-4-[5-[4-[(Z)-N'-methylsulfonylcarbamimidoyl]phenoxy]pentoxy]-N,N-di(propan-2-yl)benzamide |
| SMILES | COc1cc(C(=O)N(C(C)C)C(C)C)ccc1OCCCCCOc1ccc(/C(N)=N/S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C27H39N3O6S/c1-19(2)30(20(3)4)27(31)22-12-15-24(25(18-22)34-5)36-17-9-7-8-16-35-23-13-10-21(11-14-23)26(28)29-37(6,32)33/h10-15,18-20H,7-9,16-17H2,1-6H3,(H2,28,29) |
| InChIKey | GXTYJRQCBCWSQM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|