C30H43N3O6 — CID 54169069
propan-2-yl N-[[4-[5-[4-[di(propan-2-yl)carbamoyl]-2-methoxyphenoxy]pentoxy]phenyl]methylideneamino]carbamate (PubChem CID 54169069) has the molecular formula C30H43N3O6 and a molecular weight of 541.69 g/mol. Its IUPAC name is propan-2-yl N-[[4-[5-[4-[di(propan-2-yl)carbamoyl]-2-methoxyphenoxy]pentoxy]phenyl]methylideneamino]carbamate.
| Compound Name | propan-2-yl N-[[4-[5-[4-[di(propan-2-yl)carbamoyl]-2-methoxyphenoxy]pentoxy]phenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 54169069 |
| Molecular Formula | C30H43N3O6 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | propan-2-yl N-[[4-[5-[4-[di(propan-2-yl)carbamoyl]-2-methoxyphenoxy]pentoxy]phenyl]methylideneamino]carbamate |
| SMILES | COc1cc(C(=O)N(C(C)C)C(C)C)ccc1OCCCCCOc1ccc(C=NNC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C30H43N3O6/c1-21(2)33(22(3)4)29(34)25-13-16-27(28(19-25)36-7)38-18-10-8-9-17-37-26-14-11-24(12-15-26)20-31-32-30(35)39-23(5)6/h11-16,19-23H,8-10,17-18H2,1-7H3,(H,32,35) |
| InChIKey | OTSXUVHHRRJVDY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|