C30H44N4O5 — CID 173333916
3-methoxy-N,N-di(propan-2-yl)-4-[5-[4-[N-(propan-2-ylcarbamoyl)carbamimidoyl]phenoxy]pentoxy]benzamide (PubChem CID 173333916) has the molecular formula C30H44N4O5 and a molecular weight of 540.71 g/mol. Its IUPAC name is 3-methoxy-N,N-di(propan-2-yl)-4-[5-[4-[N-(propan-2-ylcarbamoyl)carbamimidoyl]phenoxy]pentoxy]benzamide.
| Compound Name | 3-methoxy-N,N-di(propan-2-yl)-4-[5-[4-[N-(propan-2-ylcarbamoyl)carbamimidoyl]phenoxy]pentoxy]benzamide |
|---|---|
| PubChem CID | 173333916 |
| Molecular Formula | C30H44N4O5 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | 3-methoxy-N,N-di(propan-2-yl)-4-[5-[4-[N-(propan-2-ylcarbamoyl)carbamimidoyl]phenoxy]pentoxy]benzamide |
| SMILES | [H]/N=C(\NC(=O)NC(C)C)c1ccc(OCCCCCOc2ccc(C(=O)N(C(C)C)C(C)C)cc2OC)cc1 |
| InChI | InChI=1S/C30H44N4O5/c1-20(2)32-30(36)33-28(31)23-11-14-25(15-12-23)38-17-9-8-10-18-39-26-16-13-24(19-27(26)37-7)29(35)34(21(3)4)22(5)6/h11-16,19-22H,8-10,17-18H2,1-7H3,(H3,31,32,33,36) |
| InChIKey | YAZNTKMEEPVCBP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|