C27H36ClN3O4 — CID 173333911
4-[5-[4-(N-acetylcarbamimidoyl)phenoxy]pentoxy]-2-chloro-N,N-di(propan-2-yl)benzamide (PubChem CID 173333911) has the molecular formula C27H36ClN3O4 and a molecular weight of 502.06 g/mol. Its IUPAC name is 4-[5-[4-(N-acetylcarbamimidoyl)phenoxy]pentoxy]-2-chloro-N,N-di(propan-2-yl)benzamide.
| Compound Name | 4-[5-[4-(N-acetylcarbamimidoyl)phenoxy]pentoxy]-2-chloro-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 173333911 |
| Molecular Formula | C27H36ClN3O4 |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 4-[5-[4-(N-acetylcarbamimidoyl)phenoxy]pentoxy]-2-chloro-N,N-di(propan-2-yl)benzamide |
| SMILES | [H]/N=C(\NC(C)=O)c1ccc(OCCCCCOc2ccc(C(=O)N(C(C)C)C(C)C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H36ClN3O4/c1-18(2)31(19(3)4)27(33)24-14-13-23(17-25(24)28)35-16-8-6-7-15-34-22-11-9-21(10-12-22)26(29)30-20(5)32/h9-14,17-19H,6-8,15-16H2,1-5H3,(H2,29,30,32) |
| InChIKey | GQTVZHCONZKQGH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|