C29H34N2O5 — CID 18991711
ethyl 4-[5-[4-(benzylcarbamoyl)-2-methoxyphenoxy]pentoxy]benzenecarboximidate (PubChem CID 18991711) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is ethyl 4-[5-[4-(benzylcarbamoyl)-2-methoxyphenoxy]pentoxy]benzenecarboximidate.
| Compound Name | ethyl 4-[5-[4-(benzylcarbamoyl)-2-methoxyphenoxy]pentoxy]benzenecarboximidate |
|---|---|
| PubChem CID | 18991711 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | ethyl 4-[5-[4-(benzylcarbamoyl)-2-methoxyphenoxy]pentoxy]benzenecarboximidate |
| SMILES | [H]/N=C(\OCC)c1ccc(OCCCCCOc2ccc(C(=O)NCc3ccccc3)cc2OC)cc1 |
| InChI | InChI=1S/C29H34N2O5/c1-3-34-28(30)23-12-15-25(16-13-23)35-18-8-5-9-19-36-26-17-14-24(20-27(26)33-2)29(32)31-21-22-10-6-4-7-11-22/h4,6-7,10-17,20,30H,3,5,8-9,18-19,21H2,1-2H3,(H,31,32)/b30-28- |
| InChIKey | RLIHWSQFWUWAOK-HYOGKJQXSA-N |
| XLogP | 5.62 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|