C21H26N2O5 — CID 30100434
4-(2-amino-2-oxoethoxy)-N-benzyl-3,5-dimethoxy-N-propan-2-ylbenzamide (PubChem CID 30100434) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-benzyl-3,5-dimethoxy-N-propan-2-ylbenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-benzyl-3,5-dimethoxy-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 30100434 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-benzyl-3,5-dimethoxy-N-propan-2-ylbenzamide |
| SMILES | COc1cc(C(=O)N(Cc2ccccc2)C(C)C)cc(OC)c1OCC(N)=O |
| InChI | InChI=1S/C21H26N2O5/c1-14(2)23(12-15-8-6-5-7-9-15)21(25)16-10-17(26-3)20(18(11-16)27-4)28-13-19(22)24/h5-11,14H,12-13H2,1-4H3,(H2,22,24) |
| InChIKey | LUUPKJMJPOYWSC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |