C27H31NO5 — CID 52501698
N-benzyl-3,4,5-trimethoxy-N-[(2R)-1-(2-methoxyphenyl)propan-2-yl]benzamide (PubChem CID 52501698) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-benzyl-3,4,5-trimethoxy-N-[(2R)-1-(2-methoxyphenyl)propan-2-yl]benzamide.
| Compound Name | N-benzyl-3,4,5-trimethoxy-N-[(2R)-1-(2-methoxyphenyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 52501698 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-benzyl-3,4,5-trimethoxy-N-[(2R)-1-(2-methoxyphenyl)propan-2-yl]benzamide |
| SMILES | COc1ccccc1C[C@@H](C)N(Cc1ccccc1)C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C27H31NO5/c1-19(15-21-13-9-10-14-23(21)30-2)28(18-20-11-7-6-8-12-20)27(29)22-16-24(31-3)26(33-5)25(17-22)32-4/h6-14,16-17,19H,15,18H2,1-5H3/t19-/m1/s1 |
| InChIKey | JNJNLESTULZCHA-LJQANCHMSA-N |
| XLogP | 4.99 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |