C27H41NO7 — CID 21152653
5-[ethyl-[1-(2-methoxyphenyl)propan-2-yl]amino]pentan-1-ol;3,4,5-trimethoxybenzoic acid (PubChem CID 21152653) has the molecular formula C27H41NO7 and a molecular weight of 491.63 g/mol. Its IUPAC name is 5-[ethyl-[1-(2-methoxyphenyl)propan-2-yl]amino]pentan-1-ol;3,4,5-trimethoxybenzoic acid.
| Compound Name | 5-[ethyl-[1-(2-methoxyphenyl)propan-2-yl]amino]pentan-1-ol;3,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 21152653 |
| Molecular Formula | C27H41NO7 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 5-[ethyl-[1-(2-methoxyphenyl)propan-2-yl]amino]pentan-1-ol;3,4,5-trimethoxybenzoic acid |
| SMILES | CCN(CCCCCO)C(C)Cc1ccccc1OC.COc1cc(C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C17H29NO2.C10H12O5/c1-4-18(12-8-5-9-13-19)15(2)14-16-10-6-7-11-17(16)20-3;1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h6-7,10-11,15,19H,4-5,8-9,12-14H2,1-3H3;4-5H,1-3H3,(H,11,12) |
| InChIKey | UQLYZUKESBXJBE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|