C22H31NO6 — CID 21152650
2-[ethyl(2-phenylethyl)amino]ethanol;3,4,5-trimethoxybenzoic acid (PubChem CID 21152650) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is 2-[ethyl(2-phenylethyl)amino]ethanol;3,4,5-trimethoxybenzoic acid.
| Compound Name | 2-[ethyl(2-phenylethyl)amino]ethanol;3,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 21152650 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 2-[ethyl(2-phenylethyl)amino]ethanol;3,4,5-trimethoxybenzoic acid |
| SMILES | CCN(CCO)CCc1ccccc1.COc1cc(C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C12H19NO.C10H12O5/c1-2-13(10-11-14)9-8-12-6-4-3-5-7-12;1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h3-7,14H,2,8-11H2,1H3;4-5H,1-3H3,(H,11,12) |
| InChIKey | MHPSZSFBRWUZOT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |