C26H37NO6 — CID 3051147
4-[ethyl-[1-(2-methoxyphenyl)propan-2-yl]amino]butyl 3,4,5-trimethoxybenzoate (PubChem CID 3051147) has the molecular formula C26H37NO6 and a molecular weight of 459.58 g/mol. Its IUPAC name is 4-[ethyl-[1-(2-methoxyphenyl)propan-2-yl]amino]butyl 3,4,5-trimethoxybenzoate.
| Compound Name | 4-[ethyl-[1-(2-methoxyphenyl)propan-2-yl]amino]butyl 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 3051147 |
| Molecular Formula | C26H37NO6 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 4-[ethyl-[1-(2-methoxyphenyl)propan-2-yl]amino]butyl 3,4,5-trimethoxybenzoate |
| SMILES | CCN(CCCCOC(=O)c1cc(OC)c(OC)c(OC)c1)C(C)Cc1ccccc1OC |
| InChI | InChI=1S/C26H37NO6/c1-7-27(19(2)16-20-12-8-9-13-22(20)29-3)14-10-11-15-33-26(28)21-17-23(30-4)25(32-6)24(18-21)31-5/h8-9,12-13,17-19H,7,10-11,14-16H2,1-6H3 |
| InChIKey | GBEFJBUJDJXMSH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|