C27H28O4S — CID 135979317
ethyl 6-[3-hydroxy-4-(4-phenylbenzenecarbothioyl)phenoxy]hexanoate (PubChem CID 135979317) has the molecular formula C27H28O4S and a molecular weight of 448.58 g/mol. Its IUPAC name is ethyl 6-[3-hydroxy-4-(4-phenylbenzenecarbothioyl)phenoxy]hexanoate.
| Compound Name | ethyl 6-[3-hydroxy-4-(4-phenylbenzenecarbothioyl)phenoxy]hexanoate |
|---|---|
| PubChem CID | 135979317 |
| Molecular Formula | C27H28O4S |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | ethyl 6-[3-hydroxy-4-(4-phenylbenzenecarbothioyl)phenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccc(C(=S)c2ccc(-c3ccccc3)cc2)c(O)c1 |
| InChI | InChI=1S/C27H28O4S/c1-2-30-26(29)11-7-4-8-18-31-23-16-17-24(25(28)19-23)27(32)22-14-12-21(13-15-22)20-9-5-3-6-10-20/h3,5-6,9-10,12-17,19,28H,2,4,7-8,11,18H2,1H3 |
| InChIKey | FRADPVVYGOKLDV-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|