C28H30O6 — CID 71221539
butyl 4-[3-hydroxy-4-[4-[4-(hydroxymethyl)phenyl]benzoyl]phenoxy]butanoate (PubChem CID 71221539) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is butyl 4-[3-hydroxy-4-[4-[4-(hydroxymethyl)phenyl]benzoyl]phenoxy]butanoate.
| Compound Name | butyl 4-[3-hydroxy-4-[4-[4-(hydroxymethyl)phenyl]benzoyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 71221539 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | butyl 4-[3-hydroxy-4-[4-[4-(hydroxymethyl)phenyl]benzoyl]phenoxy]butanoate |
| SMILES | CCCCOC(=O)CCCOc1ccc(C(=O)c2ccc(-c3ccc(CO)cc3)cc2)c(O)c1 |
| InChI | InChI=1S/C28H30O6/c1-2-3-16-34-27(31)5-4-17-33-24-14-15-25(26(30)18-24)28(32)23-12-10-22(11-13-23)21-8-6-20(19-29)7-9-21/h6-15,18,29-30H,2-5,16-17,19H2,1H3 |
| InChIKey | JGKKXQUSKBRFGY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|