C18H27FN2O4 — CID 55809428
ethyl 7-[2-(3-fluorophenoxy)ethylcarbamoylamino]heptanoate (PubChem CID 55809428) has the molecular formula C18H27FN2O4 and a molecular weight of 354.42 g/mol. Its IUPAC name is ethyl 7-[2-(3-fluorophenoxy)ethylcarbamoylamino]heptanoate.
| Compound Name | ethyl 7-[2-(3-fluorophenoxy)ethylcarbamoylamino]heptanoate |
|---|---|
| PubChem CID | 55809428 |
| Molecular Formula | C18H27FN2O4 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | ethyl 7-[2-(3-fluorophenoxy)ethylcarbamoylamino]heptanoate |
| SMILES | CCOC(=O)CCCCCCNC(=O)NCCOc1cccc(F)c1 |
| InChI | InChI=1S/C18H27FN2O4/c1-2-24-17(22)10-5-3-4-6-11-20-18(23)21-12-13-25-16-9-7-8-15(19)14-16/h7-9,14H,2-6,10-13H2,1H3,(H2,20,21,23) |
| InChIKey | ULVCQGPJCLKIQX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|