C15H23FN2O3 — CID 111504937
1-[2-(3-fluorophenoxy)ethyl]-3-(4-hydroxy-2,2-dimethylbutyl)urea (PubChem CID 111504937) has the molecular formula C15H23FN2O3 and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-[2-(3-fluorophenoxy)ethyl]-3-(4-hydroxy-2,2-dimethylbutyl)urea.
| Compound Name | 1-[2-(3-fluorophenoxy)ethyl]-3-(4-hydroxy-2,2-dimethylbutyl)urea |
|---|---|
| PubChem CID | 111504937 |
| Molecular Formula | C15H23FN2O3 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-[2-(3-fluorophenoxy)ethyl]-3-(4-hydroxy-2,2-dimethylbutyl)urea |
| SMILES | CC(C)(CCO)CNC(=O)NCCOc1cccc(F)c1 |
| InChI | InChI=1S/C15H23FN2O3/c1-15(2,6-8-19)11-18-14(20)17-7-9-21-13-5-3-4-12(16)10-13/h3-5,10,19H,6-9,11H2,1-2H3,(H2,17,18,20) |
| InChIKey | BGBXNJMVXQPEKH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|