C17H18ClFN2O2 — CID 112970338
1-[2-(4-chlorophenyl)ethyl]-3-[2-(3-fluorophenoxy)ethyl]urea (PubChem CID 112970338) has the molecular formula C17H18ClFN2O2 and a molecular weight of 336.79 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-[2-(3-fluorophenoxy)ethyl]urea.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-[2-(3-fluorophenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112970338 |
| Molecular Formula | C17H18ClFN2O2 |
| Molecular Weight | 336.79 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-[2-(3-fluorophenoxy)ethyl]urea |
| SMILES | O=C(NCCOc1cccc(F)c1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClFN2O2/c18-14-6-4-13(5-7-14)8-9-20-17(22)21-10-11-23-16-3-1-2-15(19)12-16/h1-7,12H,8-11H2,(H2,20,21,22) |
| InChIKey | SLWCBJLWWZNCEK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.79 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|