C19H20Br2N2O3 — CID 11684473
(2R)-3-(4-amino-3,5-dibromophenyl)-2-(4-phenylbutanoylamino)propanoic acid (PubChem CID 11684473) has the molecular formula C19H20Br2N2O3 and a molecular weight of 484.19 g/mol. Its IUPAC name is (2R)-3-(4-amino-3,5-dibromophenyl)-2-(4-phenylbutanoylamino)propanoic acid.
| Compound Name | (2R)-3-(4-amino-3,5-dibromophenyl)-2-(4-phenylbutanoylamino)propanoic acid |
|---|---|
| PubChem CID | 11684473 |
| Molecular Formula | C19H20Br2N2O3 |
| Molecular Weight | 484.19 g/mol |
| Exact Mass | 481.98 |
| IUPAC Name | (2R)-3-(4-amino-3,5-dibromophenyl)-2-(4-phenylbutanoylamino)propanoic acid |
| SMILES | Nc1c(Br)cc(C[C@@H](NC(=O)CCCc2ccccc2)C(=O)O)cc1Br |
| InChI | InChI=1S/C19H20Br2N2O3/c20-14-9-13(10-15(21)18(14)22)11-16(19(25)26)23-17(24)8-4-7-12-5-2-1-3-6-12/h1-3,5-6,9-10,16H,4,7-8,11,22H2,(H,23,24)(H,25,26)/t16-/m1/s1 |
| InChIKey | OTIUUHZCCLVPKH-MRXNPFEDSA-N |
| XLogP | 3.93 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.19 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|