C35H44Br2N6O3 — CID 11657943
N-[(2R)-3-(4-amino-3,5-dibromophenyl)-1-[[(2S)-6-amino-1-oxo-1-(4-phenylpiperazin-1-yl)hexan-2-yl]amino]-1-oxopropan-2-yl]-4-phenylbutanamide (PubChem CID 11657943) has the molecular formula C35H44Br2N6O3 and a molecular weight of 756.58 g/mol. Its IUPAC name is N-[(2R)-3-(4-amino-3,5-dibromophenyl)-1-[[(2S)-6-amino-1-oxo-1-(4-phenylpiperazin-1-yl)hexan-2-yl]amino]-1-oxopropan-2-yl]-4-phenylbutanamide.
| Compound Name | N-[(2R)-3-(4-amino-3,5-dibromophenyl)-1-[[(2S)-6-amino-1-oxo-1-(4-phenylpiperazin-1-yl)hexan-2-yl]amino]-1-oxopropan-2-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 11657943 |
| Molecular Formula | C35H44Br2N6O3 |
| Molecular Weight | 756.58 g/mol |
| Exact Mass | 754.18 |
| IUPAC Name | N-[(2R)-3-(4-amino-3,5-dibromophenyl)-1-[[(2S)-6-amino-1-oxo-1-(4-phenylpiperazin-1-yl)hexan-2-yl]amino]-1-oxopropan-2-yl]-4-phenylbutanamide |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](Cc1cc(Br)c(N)c(Br)c1)NC(=O)CCCc1ccccc1)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C35H44Br2N6O3/c36-28-22-26(23-29(37)33(28)39)24-31(40-32(44)16-9-12-25-10-3-1-4-11-25)34(45)41-30(15-7-8-17-38)35(46)43-20-18-42(19-21-43)27-13-5-2-6-14-27/h1-6,10-11,13-14,22-23,30-31H,7-9,12,15-21,24,38-39H2,(H,40,44)(H,41,45)/t30-,31+/m0/s1 |
| InChIKey | RDDDYNLVALUVJX-IOWSJCHKSA-N |
| XLogP | 4.81 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|