C42H54Br2N6O7 — CID 11578833
tert-butyl 4-[(2S)-2-[[(2R)-3-(4-amino-3,5-dibromophenyl)-2-(4-phenylbutanoylamino)propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoyl]piperazine-1-carboxylate (PubChem CID 11578833) has the molecular formula C42H54Br2N6O7 and a molecular weight of 914.74 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-2-[[(2R)-3-(4-amino-3,5-dibromophenyl)-2-(4-phenylbutanoylamino)propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-2-[[(2R)-3-(4-amino-3,5-dibromophenyl)-2-(4-phenylbutanoylamino)propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 11578833 |
| Molecular Formula | C42H54Br2N6O7 |
| Molecular Weight | 914.74 g/mol |
| Exact Mass | 912.24 |
| IUPAC Name | tert-butyl 4-[(2S)-2-[[(2R)-3-(4-amino-3,5-dibromophenyl)-2-(4-phenylbutanoylamino)propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)[C@H](CCCCNC(=O)OCc2ccccc2)NC(=O)[C@@H](Cc2cc(Br)c(N)c(Br)c2)NC(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C42H54Br2N6O7/c1-42(2,3)57-41(55)50-23-21-49(22-24-50)39(53)34(18-10-11-20-46-40(54)56-28-30-15-8-5-9-16-30)48-38(52)35(27-31-25-32(43)37(45)33(44)26-31)47-36(51)19-12-17-29-13-6-4-7-14-29/h4-9,13-16,25-26,34-35H,10-12,17-24,27-28,45H2,1-3H3,(H,46,54)(H,47,51)(H,48,52)/t34-,35+/m0/s1 |
| InChIKey | UZSKGHMZLGMBDM-OIDHKYIRSA-N |
| XLogP | 6.50 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.74 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|