C31H48N3O3+ — CID 75059079
trimethyl-[4-(2-methylpropoxy)-4-oxo-2-[7-(4-phenylphenyl)heptylcarbamoylamino]butyl]azanium (PubChem CID 75059079) has the molecular formula C31H48N3O3+ and a molecular weight of 510.74 g/mol. Its IUPAC name is trimethyl-[4-(2-methylpropoxy)-4-oxo-2-[7-(4-phenylphenyl)heptylcarbamoylamino]butyl]azanium.
| Compound Name | trimethyl-[4-(2-methylpropoxy)-4-oxo-2-[7-(4-phenylphenyl)heptylcarbamoylamino]butyl]azanium |
|---|---|
| PubChem CID | 75059079 |
| Molecular Formula | C31H48N3O3+ |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | trimethyl-[4-(2-methylpropoxy)-4-oxo-2-[7-(4-phenylphenyl)heptylcarbamoylamino]butyl]azanium |
| SMILES | CC(C)COC(=O)CC(C[N+](C)(C)C)NC(=O)NCCCCCCCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H47N3O3/c1-25(2)24-37-30(35)22-29(23-34(3,4)5)33-31(36)32-21-13-8-6-7-10-14-26-17-19-28(20-18-26)27-15-11-9-12-16-27/h9,11-12,15-20,25,29H,6-8,10,13-14,21-24H2,1-5H3,(H-,32,33,36)/p+1 |
| InChIKey | AQYXVBKIWBOONP-UHFFFAOYSA-O |
| XLogP | 5.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|