C25H37N2O4S+ — CID 68744071
trimethyl-[(2R)-4-oxo-2-[(4-pentylphenyl)sulfonylamino]-4-phenylmethoxybutyl]azanium (PubChem CID 68744071) has the molecular formula C25H37N2O4S+ and a molecular weight of 461.65 g/mol. Its IUPAC name is trimethyl-[(2R)-4-oxo-2-[(4-pentylphenyl)sulfonylamino]-4-phenylmethoxybutyl]azanium.
| Compound Name | trimethyl-[(2R)-4-oxo-2-[(4-pentylphenyl)sulfonylamino]-4-phenylmethoxybutyl]azanium |
|---|---|
| PubChem CID | 68744071 |
| Molecular Formula | C25H37N2O4S+ |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | trimethyl-[(2R)-4-oxo-2-[(4-pentylphenyl)sulfonylamino]-4-phenylmethoxybutyl]azanium |
| SMILES | CCCCCc1ccc(S(=O)(=O)N[C@H](CC(=O)OCc2ccccc2)C[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C25H37N2O4S/c1-5-6-8-11-21-14-16-24(17-15-21)32(29,30)26-23(19-27(2,3)4)18-25(28)31-20-22-12-9-7-10-13-22/h7,9-10,12-17,23,26H,5-6,8,11,18-20H2,1-4H3/q+1/t23-/m1/s1 |
| InChIKey | WUKHPOMRZUFGJD-HSZRJFAPSA-N |
| XLogP | 3.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|