C26H39N3O4S — CID 68742784
3-[[4-[2-(4-pentylphenyl)ethyl]phenyl]sulfamoylamino]-4-(trimethylazaniumyl)butanoate (PubChem CID 68742784) has the molecular formula C26H39N3O4S and a molecular weight of 489.68 g/mol. Its IUPAC name is 3-[[4-[2-(4-pentylphenyl)ethyl]phenyl]sulfamoylamino]-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[[4-[2-(4-pentylphenyl)ethyl]phenyl]sulfamoylamino]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 68742784 |
| Molecular Formula | C26H39N3O4S |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 3-[[4-[2-(4-pentylphenyl)ethyl]phenyl]sulfamoylamino]-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCc1ccc(CCc2ccc(NS(=O)(=O)NC(CC(=O)[O-])C[N+](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H39N3O4S/c1-5-6-7-8-21-9-11-22(12-10-21)13-14-23-15-17-24(18-16-23)27-34(32,33)28-25(19-26(30)31)20-29(2,3)4/h9-12,15-18,25,27-28H,5-8,13-14,19-20H2,1-4H3 |
| InChIKey | XPULNNQUNVSELV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|