C18H32IN3O4S — CID 145473442
[(2R)-3-carboxy-2-[(4-pentylphenyl)sulfamoylamino]propyl]iodanuidyl-trimethylazanium (PubChem CID 145473442) has the molecular formula C18H32IN3O4S and a molecular weight of 513.44 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[(4-pentylphenyl)sulfamoylamino]propyl]iodanuidyl-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[(4-pentylphenyl)sulfamoylamino]propyl]iodanuidyl-trimethylazanium |
|---|---|
| PubChem CID | 145473442 |
| Molecular Formula | C18H32IN3O4S |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | [(2R)-3-carboxy-2-[(4-pentylphenyl)sulfamoylamino]propyl]iodanuidyl-trimethylazanium |
| SMILES | CCCCCc1ccc(NS(=O)(=O)N[C@@H](C[I-][N+](C)(C)C)CC(=O)O)cc1 |
| InChI | InChI=1S/C18H32IN3O4S/c1-5-6-7-8-15-9-11-16(12-10-15)20-27(25,26)21-17(13-18(23)24)14-19-22(2,3)4/h9-12,17,20-21H,5-8,13-14H2,1-4H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | YHDAADSGBIBFDW-QGZVFWFLSA-N |
| XLogP | -0.78 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|