C22H40N3O4S+ — CID 68743637
[(2R)-3-carboxy-2-[methyl-[(4-octylphenyl)sulfamoyl]amino]propyl]-trimethylazanium (PubChem CID 68743637) has the molecular formula C22H40N3O4S+ and a molecular weight of 442.65 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[methyl-[(4-octylphenyl)sulfamoyl]amino]propyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[methyl-[(4-octylphenyl)sulfamoyl]amino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 68743637 |
| Molecular Formula | C22H40N3O4S+ |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | [(2R)-3-carboxy-2-[methyl-[(4-octylphenyl)sulfamoyl]amino]propyl]-trimethylazanium |
| SMILES | CCCCCCCCc1ccc(NS(=O)(=O)N(C)[C@H](CC(=O)O)C[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C22H39N3O4S/c1-6-7-8-9-10-11-12-19-13-15-20(16-14-19)23-30(28,29)24(2)21(17-22(26)27)18-25(3,4)5/h13-16,21,23H,6-12,17-18H2,1-5H3/p+1/t21-/m1/s1 |
| InChIKey | QWEKIXMFCWHVJR-OAQYLSRUSA-O |
| XLogP | 3.73 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|