C26H40N3O4S+ — CID 91508621
[(2S)-3-carboxy-2-[[4-[2-(4-pentylphenyl)ethyl]phenyl]sulfamoylamino]propyl]-trimethylazanium (PubChem CID 91508621) has the molecular formula C26H40N3O4S+ and a molecular weight of 490.69 g/mol. Its IUPAC name is [(2S)-3-carboxy-2-[[4-[2-(4-pentylphenyl)ethyl]phenyl]sulfamoylamino]propyl]-trimethylazanium.
| Compound Name | [(2S)-3-carboxy-2-[[4-[2-(4-pentylphenyl)ethyl]phenyl]sulfamoylamino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 91508621 |
| Molecular Formula | C26H40N3O4S+ |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | [(2S)-3-carboxy-2-[[4-[2-(4-pentylphenyl)ethyl]phenyl]sulfamoylamino]propyl]-trimethylazanium |
| SMILES | CCCCCc1ccc(CCc2ccc(NS(=O)(=O)N[C@@H](CC(=O)O)C[N+](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H39N3O4S/c1-5-6-7-8-21-9-11-22(12-10-21)13-14-23-15-17-24(18-16-23)27-34(32,33)28-25(19-26(30)31)20-29(2,3)4/h9-12,15-18,25,27-28H,5-8,13-14,19-20H2,1-4H3/p+1/t25-/m0/s1 |
| InChIKey | XPULNNQUNVSELV-VWLOTQADSA-O |
| XLogP | 4.00 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|