C18H32N3O4S+ — CID 25067155
[(2R)-3-carboxy-2-[[methyl(4-phenylbutyl)sulfamoyl]amino]propyl]-trimethylazanium (PubChem CID 25067155) has the molecular formula C18H32N3O4S+ and a molecular weight of 386.54 g/mol. Its IUPAC name is [(2R)-3-carboxy-2-[[methyl(4-phenylbutyl)sulfamoyl]amino]propyl]-trimethylazanium.
| Compound Name | [(2R)-3-carboxy-2-[[methyl(4-phenylbutyl)sulfamoyl]amino]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 25067155 |
| Molecular Formula | C18H32N3O4S+ |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [(2R)-3-carboxy-2-[[methyl(4-phenylbutyl)sulfamoyl]amino]propyl]-trimethylazanium |
| SMILES | CN(CCCCc1ccccc1)S(=O)(=O)N[C@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C18H31N3O4S/c1-20(13-9-8-12-16-10-6-5-7-11-16)26(24,25)19-17(14-18(22)23)15-21(2,3)4/h5-7,10-11,17,19H,8-9,12-15H2,1-4H3/p+1/t17-/m1/s1 |
| InChIKey | IVALJPAXICRUCX-QGZVFWFLSA-O |
| XLogP | 1.33 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|