C18H23NO2S — CID 22024838
N-methyl-N-(5-phenylpentyl)benzenesulfonamide (PubChem CID 22024838) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is N-methyl-N-(5-phenylpentyl)benzenesulfonamide.
| Compound Name | N-methyl-N-(5-phenylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22024838 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-methyl-N-(5-phenylpentyl)benzenesulfonamide |
| SMILES | CN(CCCCCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H23NO2S/c1-19(22(20,21)18-14-8-3-9-15-18)16-10-4-7-13-17-11-5-2-6-12-17/h2-3,5-6,8-9,11-12,14-15H,4,7,10,13,16H2,1H3 |
| InChIKey | AENKWMOQZMEILX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|