C20H33NO4S — CID 15319363
(2S)-12-[benzenesulfonyl(methyl)amino]-2-methyldodecanoic acid (PubChem CID 15319363) has the molecular formula C20H33NO4S and a molecular weight of 383.55 g/mol. Its IUPAC name is (2S)-12-[benzenesulfonyl(methyl)amino]-2-methyldodecanoic acid.
| Compound Name | (2S)-12-[benzenesulfonyl(methyl)amino]-2-methyldodecanoic acid |
|---|---|
| PubChem CID | 15319363 |
| Molecular Formula | C20H33NO4S |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (2S)-12-[benzenesulfonyl(methyl)amino]-2-methyldodecanoic acid |
| SMILES | C[C@@H](CCCCCCCCCCN(C)S(=O)(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H33NO4S/c1-18(20(22)23)14-10-7-5-3-4-6-8-13-17-21(2)26(24,25)19-15-11-9-12-16-19/h9,11-12,15-16,18H,3-8,10,13-14,17H2,1-2H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | CJRQENRVARBDFX-SFHVURJKSA-N |
| XLogP | 4.54 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|