C22H32BNO5S — CID 66915469
[4-[3-[benzenesulfonyl(methyl)amino]propyl]phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 66915469) has the molecular formula C22H32BNO5S and a molecular weight of 433.38 g/mol. Its IUPAC name is [4-[3-[benzenesulfonyl(methyl)amino]propyl]phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | [4-[3-[benzenesulfonyl(methyl)amino]propyl]phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 66915469 |
| Molecular Formula | C22H32BNO5S |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | [4-[3-[benzenesulfonyl(methyl)amino]propyl]phenyl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CN(CCCc1ccc(B(O)OC(C)(C)C(C)(C)O)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H32BNO5S/c1-21(2,25)22(3,4)29-23(26)19-15-13-18(14-16-19)10-9-17-24(5)30(27,28)20-11-7-6-8-12-20/h6-8,11-16,25-26H,9-10,17H2,1-5H3 |
| InChIKey | WTHIUXRAUKDMLS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|