C21H28BNO5 — CID 75492909
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-[methyl(phenylmethoxycarbonyl)amino]phenyl]borinic acid (PubChem CID 75492909) has the molecular formula C21H28BNO5 and a molecular weight of 385.27 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-[methyl(phenylmethoxycarbonyl)amino]phenyl]borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-[methyl(phenylmethoxycarbonyl)amino]phenyl]borinic acid |
|---|---|
| PubChem CID | 75492909 |
| Molecular Formula | C21H28BNO5 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-[methyl(phenylmethoxycarbonyl)amino]phenyl]borinic acid |
| SMILES | CN(C(=O)OCc1ccccc1)c1ccc(B(O)OC(C)(C)C(C)(C)O)cc1 |
| InChI | InChI=1S/C21H28BNO5/c1-20(2,25)21(3,4)28-22(26)17-11-13-18(14-12-17)23(5)19(24)27-15-16-9-7-6-8-10-16/h6-14,25-26H,15H2,1-5H3 |
| InChIKey | CXKUKKBOOAJAJQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|