C15H17ClN2O2S — CID 61053398
2-chloro-N-methyl-N-(3-phenylpropyl)pyridine-4-sulfonamide (PubChem CID 61053398) has the molecular formula C15H17ClN2O2S and a molecular weight of 324.83 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(3-phenylpropyl)pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-methyl-N-(3-phenylpropyl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 61053398 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-chloro-N-methyl-N-(3-phenylpropyl)pyridine-4-sulfonamide |
| SMILES | CN(CCCc1ccccc1)S(=O)(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C15H17ClN2O2S/c1-18(11-5-8-13-6-3-2-4-7-13)21(19,20)14-9-10-17-15(16)12-14/h2-4,6-7,9-10,12H,5,8,11H2,1H3 |
| InChIKey | LVKCYZNNWKNZGT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|