C27H39N3O4S — CID 132619643
2-[4-[benzenesulfonyl(methyl)amino]butanoyl-(2-phenylethyl)amino]-N-tert-butylbutanamide (PubChem CID 132619643) has the molecular formula C27H39N3O4S and a molecular weight of 501.69 g/mol. Its IUPAC name is 2-[4-[benzenesulfonyl(methyl)amino]butanoyl-(2-phenylethyl)amino]-N-tert-butylbutanamide.
| Compound Name | 2-[4-[benzenesulfonyl(methyl)amino]butanoyl-(2-phenylethyl)amino]-N-tert-butylbutanamide |
|---|---|
| PubChem CID | 132619643 |
| Molecular Formula | C27H39N3O4S |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 2-[4-[benzenesulfonyl(methyl)amino]butanoyl-(2-phenylethyl)amino]-N-tert-butylbutanamide |
| SMILES | CCC(C(=O)NC(C)(C)C)N(CCc1ccccc1)C(=O)CCCN(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H39N3O4S/c1-6-24(26(32)28-27(2,3)4)30(21-19-22-14-9-7-10-15-22)25(31)18-13-20-29(5)35(33,34)23-16-11-8-12-17-23/h7-12,14-17,24H,6,13,18-21H2,1-5H3,(H,28,32) |
| InChIKey | BFNIHYQPLWXJEP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |