C23H31N3O4S — CID 132673536
2-[4-[benzenesulfonyl(methyl)amino]butanoyl-benzylamino]-N-methylbutanamide (PubChem CID 132673536) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is 2-[4-[benzenesulfonyl(methyl)amino]butanoyl-benzylamino]-N-methylbutanamide.
| Compound Name | 2-[4-[benzenesulfonyl(methyl)amino]butanoyl-benzylamino]-N-methylbutanamide |
|---|---|
| PubChem CID | 132673536 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-[4-[benzenesulfonyl(methyl)amino]butanoyl-benzylamino]-N-methylbutanamide |
| SMILES | CCC(C(=O)NC)N(Cc1ccccc1)C(=O)CCCN(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O4S/c1-4-21(23(28)24-2)26(18-19-12-7-5-8-13-19)22(27)16-11-17-25(3)31(29,30)20-14-9-6-10-15-20/h5-10,12-15,21H,4,11,16-18H2,1-3H3,(H,24,28) |
| InChIKey | COLNUGUNLZZJCV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |