C19H31IN2O4S — CID 145473522
(3R)-4-iodo-3-[[methyl-(4-octylphenyl)sulfamoyl]amino]butanoic acid (PubChem CID 145473522) has the molecular formula C19H31IN2O4S and a molecular weight of 510.44 g/mol. Its IUPAC name is (3R)-4-iodo-3-[[methyl-(4-octylphenyl)sulfamoyl]amino]butanoic acid.
| Compound Name | (3R)-4-iodo-3-[[methyl-(4-octylphenyl)sulfamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 145473522 |
| Molecular Formula | C19H31IN2O4S |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | (3R)-4-iodo-3-[[methyl-(4-octylphenyl)sulfamoyl]amino]butanoic acid |
| SMILES | CCCCCCCCc1ccc(N(C)S(=O)(=O)N[C@@H](CI)CC(=O)O)cc1 |
| InChI | InChI=1S/C19H31IN2O4S/c1-3-4-5-6-7-8-9-16-10-12-18(13-11-16)22(2)27(25,26)21-17(15-20)14-19(23)24/h10-13,17,21H,3-9,14-15H2,1-2H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | GUSKQWDJWSAKRG-QGZVFWFLSA-N |
| XLogP | 4.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|